ChemNet > CAS > 175278-50-9 3-{4-[(4-메틸페닐)티오]-3-니트로페닐}아크릴산
175278-50-9 3-{4-[(4-메틸페닐)티오]-3-니트로페닐}아크릴산
| 상품명칭 |
3-{4-[(4-메틸페닐)티오]-3-니트로페닐}아크릴산 |
| 별명 |
; 3-[4-[(4-메틸페닐)티오]-3-니트로페닐]아크릴산; (2E)-3-{4-[(4-메틸페닐)설파닐]-3-니트로페닐}프로프-2-에노산 |
| 영문 이름 |
3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid; 3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid |
| 분자식 |
C16H13NO4S |
| 분자량 |
315.3437 |
| InChI |
InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+ |
| cas번호 |
175278-50-9 |
| 분자 구조 |
|
| 밀도 |
1.38g/cm3 |
| 녹는 점 |
217℃ |
| 비등점 |
505°C at 760 mmHg |
| 굴절 지수 |
1.673 |
| 인화점 |
259.2°C |
| 증기압 |
5.08E-11mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|